C24H15ClN4OS2 — CID 10790718
7-(2-chlorophenyl)-3,11-diphenyl-10-oxa-5-thia-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),8,11-triene-4-thione (PubChem CID 10790718) has the molecular formula C24H15ClN4OS2 and a molecular weight of 475.00 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-3,11-diphenyl-10-oxa-5-thia-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),8,11-triene-4-thione.
| Compound Name | 7-(2-chlorophenyl)-3,11-diphenyl-10-oxa-5-thia-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),8,11-triene-4-thione |
|---|---|
| PubChem CID | 10790718 |
| Molecular Formula | C24H15ClN4OS2 |
| Molecular Weight | 475.00 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 7-(2-chlorophenyl)-3,11-diphenyl-10-oxa-5-thia-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),8,11-triene-4-thione |
| SMILES | S=c1sc2c(n1-c1ccccc1)N1N=C(c3ccccc3)OC1=NC2c1ccccc1Cl |
| InChI | InChI=1S/C24H15ClN4OS2/c25-18-14-8-7-13-17(18)19-20-22(28(24(31)32-20)16-11-5-2-6-12-16)29-23(26-19)30-21(27-29)15-9-3-1-4-10-15/h1-14,19H |
| InChIKey | LZUOTXAXZLMORS-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.00 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|