About N-(2,2-difluoroethyl)cyclohex-2-en-1-amine
N-(2,2-difluoroethyl)cyclohex-2-en-1-amine (PubChem CID 107907618) has the molecular formula C8H13F2N
and a molecular weight of 161.19 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)cyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)cyclohex-2-en-1-amine |
| PubChem CID | 107907618 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N-(2,2-difluoroethyl)cyclohex-2-en-1-amine |
| SMILES | FC(F)CNC1C=CCCC1 |
| InChI | InChI=1S/C8H13F2N/c9-8(10)6-11-7-4-2-1-3-5-7/h2,4,7-8,11H,1,3,5-6H2 |
| InChIKey | PFGOBGWUGMUWGL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-difluoroethyl)cyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)cyclohex-2-en-1-amine?
The IUPAC name of N-(2,2-difluoroethyl)cyclohex-2-en-1-amine (CID 107907618) is N-(2,2-difluoroethyl)cyclohex-2-en-1-amine.
What is the SMILES notation for N-(2,2-difluoroethyl)cyclohex-2-en-1-amine?
The canonical SMILES for N-(2,2-difluoroethyl)cyclohex-2-en-1-amine is FC(F)CNC1C=CCCC1.
What is the InChIKey of N-(2,2-difluoroethyl)cyclohex-2-en-1-amine?
The InChIKey is PFGOBGWUGMUWGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2N/c9-8(10)6-11-7-4-2-1-3-5-7/h2,4,7-8,11H,1,3,5-6H2.
What are the key properties of N-(2,2-difluoroethyl)cyclohex-2-en-1-amine?
N-(2,2-difluoroethyl)cyclohex-2-en-1-amine has a molecular weight of 161.19 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)cyclohex-2-en-1-amine is sourced from PubChem (CID 107907618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).