About 2-but-3-en-2-yl-1,1-dimethylhydrazine
2-but-3-en-2-yl-1,1-dimethylhydrazine (PubChem CID 107907712) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is 2-but-3-en-2-yl-1,1-dimethylhydrazine.
Molecular Properties
| Compound Name | 2-but-3-en-2-yl-1,1-dimethylhydrazine |
| PubChem CID | 107907712 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 2-but-3-en-2-yl-1,1-dimethylhydrazine |
| SMILES | C=CC(C)NN(C)C |
| InChI | InChI=1S/C6H14N2/c1-5-6(2)7-8(3)4/h5-7H,1H2,2-4H3 |
| InChIKey | HDCSPVUJEFTWMO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-en-2-yl-1,1-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-en-2-yl-1,1-dimethylhydrazine?
The IUPAC name of 2-but-3-en-2-yl-1,1-dimethylhydrazine (CID 107907712) is 2-but-3-en-2-yl-1,1-dimethylhydrazine.
What is the SMILES notation for 2-but-3-en-2-yl-1,1-dimethylhydrazine?
The canonical SMILES for 2-but-3-en-2-yl-1,1-dimethylhydrazine is C=CC(C)NN(C)C.
What is the InChIKey of 2-but-3-en-2-yl-1,1-dimethylhydrazine?
The InChIKey is HDCSPVUJEFTWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-5-6(2)7-8(3)4/h5-7H,1H2,2-4H3.
What are the key properties of 2-but-3-en-2-yl-1,1-dimethylhydrazine?
2-but-3-en-2-yl-1,1-dimethylhydrazine has a molecular weight of 114.19 g/mol, XLogP of 0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-en-2-yl-1,1-dimethylhydrazine is sourced from PubChem (CID 107907712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).