C21H20NO4+ — CID 10790783
16-ethoxy-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 10790783) has the molecular formula C21H20NO4+ and a molecular weight of 350.39 g/mol. Its IUPAC name is 16-ethoxy-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 16-ethoxy-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 10790783 |
| Molecular Formula | C21H20NO4+ |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 16-ethoxy-17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | CCOc1c(OC)ccc2cc3[n+](cc12)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C21H20NO4/c1-3-24-21-16-11-22-7-6-14-9-19-20(26-12-25-19)10-15(14)17(22)8-13(16)4-5-18(21)23-2/h4-5,8-11H,3,6-7,12H2,1-2H3/q+1 |
| InChIKey | XXOBQDKCHCDZQI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|