C11H18BrN3O — CID 107908503
5-bromo-N-(1-imidazol-1-ylpropan-2-yl)pentanamide (PubChem CID 107908503) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is 5-bromo-N-(1-imidazol-1-ylpropan-2-yl)pentanamide.
| Compound Name | 5-bromo-N-(1-imidazol-1-ylpropan-2-yl)pentanamide |
|---|---|
| PubChem CID | 107908503 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-bromo-N-(1-imidazol-1-ylpropan-2-yl)pentanamide |
| SMILES | CC(Cn1ccnc1)NC(=O)CCCCBr |
| InChI | InChI=1S/C11H18BrN3O/c1-10(8-15-7-6-13-9-15)14-11(16)4-2-3-5-12/h6-7,9-10H,2-5,8H2,1H3,(H,14,16) |
| InChIKey | HMUFTZSUWZHUIX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|