C14H15FN4 — CID 107909026
2-[[2-(2-aminopropyl)imidazol-1-yl]methyl]-4-fluorobenzonitrile (PubChem CID 107909026) has the molecular formula C14H15FN4 and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-[[2-(2-aminopropyl)imidazol-1-yl]methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[[2-(2-aminopropyl)imidazol-1-yl]methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107909026 |
| Molecular Formula | C14H15FN4 |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-[[2-(2-aminopropyl)imidazol-1-yl]methyl]-4-fluorobenzonitrile |
| SMILES | CC(N)Cc1nccn1Cc1cc(F)ccc1C#N |
| InChI | InChI=1S/C14H15FN4/c1-10(17)6-14-18-4-5-19(14)9-12-7-13(15)3-2-11(12)8-16/h2-5,7,10H,6,9,17H2,1H3 |
| InChIKey | WKRRVTSJYJTMKT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |