C14H21BrN2O — CID 107909493
5-bromo-N-propan-2-yl-N-(pyridin-2-ylmethyl)pentanamide (PubChem CID 107909493) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is 5-bromo-N-propan-2-yl-N-(pyridin-2-ylmethyl)pentanamide.
| Compound Name | 5-bromo-N-propan-2-yl-N-(pyridin-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 107909493 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 5-bromo-N-propan-2-yl-N-(pyridin-2-ylmethyl)pentanamide |
| SMILES | CC(C)N(Cc1ccccn1)C(=O)CCCCBr |
| InChI | InChI=1S/C14H21BrN2O/c1-12(2)17(14(18)8-3-5-9-15)11-13-7-4-6-10-16-13/h4,6-7,10,12H,3,5,8-9,11H2,1-2H3 |
| InChIKey | SUSRYTQEIBTZOS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|