C15H19BrN2O2 — CID 107909776
5-bromo-N-[2-(2-oxopyrrolidin-1-yl)phenyl]pentanamide (PubChem CID 107909776) has the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. Its IUPAC name is 5-bromo-N-[2-(2-oxopyrrolidin-1-yl)phenyl]pentanamide.
| Compound Name | 5-bromo-N-[2-(2-oxopyrrolidin-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 107909776 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 5-bromo-N-[2-(2-oxopyrrolidin-1-yl)phenyl]pentanamide |
| SMILES | O=C(CCCCBr)Nc1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C15H19BrN2O2/c16-10-4-3-8-14(19)17-12-6-1-2-7-13(12)18-11-5-9-15(18)20/h1-2,6-7H,3-5,8-11H2,(H,17,19) |
| InChIKey | SIDKJQHWQASETI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|