C13H24BrNO — CID 107910275
5-bromo-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]pentanamide (PubChem CID 107910275) has the molecular formula C13H24BrNO and a molecular weight of 290.25 g/mol. Its IUPAC name is 5-bromo-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]pentanamide.
| Compound Name | 5-bromo-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]pentanamide |
|---|---|
| PubChem CID | 107910275 |
| Molecular Formula | C13H24BrNO |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-bromo-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]pentanamide |
| SMILES | CC1(C)C(CNC(=O)CCCCBr)C1(C)C |
| InChI | InChI=1S/C13H24BrNO/c1-12(2)10(13(12,3)4)9-15-11(16)7-5-6-8-14/h10H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | PWDKGUJKORTNKG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|