C16H25BrN2O — CID 107911135
1-[2-bromo-5-[2-(1-methylpiperidin-2-yl)ethoxy]phenyl]-N-methylmethanamine (PubChem CID 107911135) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-[2-bromo-5-[2-(1-methylpiperidin-2-yl)ethoxy]phenyl]-N-methylmethanamine.
| Compound Name | 1-[2-bromo-5-[2-(1-methylpiperidin-2-yl)ethoxy]phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107911135 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-[2-bromo-5-[2-(1-methylpiperidin-2-yl)ethoxy]phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(OCCC2CCCCN2C)ccc1Br |
| InChI | InChI=1S/C16H25BrN2O/c1-18-12-13-11-15(6-7-16(13)17)20-10-8-14-5-3-4-9-19(14)2/h6-7,11,14,18H,3-5,8-10,12H2,1-2H3 |
| InChIKey | KVGCRXNYDLMATJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |