C27H34O6S — CID 10791122
2-[4-[(8S,9R,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]phenoxy]ethyl methanesulfonate (PubChem CID 10791122) has the molecular formula C27H34O6S and a molecular weight of 486.63 g/mol. Its IUPAC name is 2-[4-[(8S,9R,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]phenoxy]ethyl methanesulfonate.
| Compound Name | 2-[4-[(8S,9R,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]phenoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 10791122 |
| Molecular Formula | C27H34O6S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[4-[(8S,9R,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]phenoxy]ethyl methanesulfonate |
| SMILES | C[C@]12C[C@H](c3ccc(OCCOS(C)(=O)=O)cc3)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C27H34O6S/c1-27-16-23(17-3-7-20(8-4-17)32-13-14-33-34(2,30)31)26-21-10-6-19(28)15-18(21)5-9-22(26)24(27)11-12-25(27)29/h3-4,6-8,10,15,22-26,28-29H,5,9,11-14,16H2,1-2H3/t22-,23+,24-,25-,26+,27-/m0/s1 |
| InChIKey | WRKLYIRTAZLCBT-NOIWARKYSA-N |
| XLogP | 4.36 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|