C9H20N2O2 — CID 107911684
2-(2-pyrrolidin-1-ylethylamino)propane-1,3-diol (PubChem CID 107911684) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(2-pyrrolidin-1-ylethylamino)propane-1,3-diol.
| Compound Name | 2-(2-pyrrolidin-1-ylethylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 107911684 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 2-(2-pyrrolidin-1-ylethylamino)propane-1,3-diol |
| SMILES | OCC(CO)NCCN1CCCC1 |
| InChI | InChI=1S/C9H20N2O2/c12-7-9(8-13)10-3-6-11-4-1-2-5-11/h9-10,12-13H,1-8H2 |
| InChIKey | SKFGZCMYZXQNTJ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |