C28H28FN3O4 — CID 10791205
phenyl N-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 10791205) has the molecular formula C28H28FN3O4 and a molecular weight of 489.55 g/mol. Its IUPAC name is phenyl N-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | phenyl N-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 10791205 |
| Molecular Formula | C28H28FN3O4 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | phenyl N-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | CC(C)(C)CCN1C(=O)C(NC(=O)Oc2ccccc2)C(=O)N(c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C28H28FN3O4/c1-28(2,3)17-18-31-22-15-9-10-16-23(22)32(21-14-8-7-13-20(21)29)26(34)24(25(31)33)30-27(35)36-19-11-5-4-6-12-19/h4-16,24H,17-18H2,1-3H3,(H,30,35) |
| InChIKey | ZMJUPHZXOROMGT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|