C23H17N3O6S2 — CID 10791372
(2R)-3-(1H-indol-3-yl)-2-[[5-[2-(4-nitrophenyl)ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid (PubChem CID 10791372) has the molecular formula C23H17N3O6S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is (2R)-3-(1H-indol-3-yl)-2-[[5-[2-(4-nitrophenyl)ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid.
| Compound Name | (2R)-3-(1H-indol-3-yl)-2-[[5-[2-(4-nitrophenyl)ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 10791372 |
| Molecular Formula | C23H17N3O6S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | (2R)-3-(1H-indol-3-yl)-2-[[5-[2-(4-nitrophenyl)ethynyl]thiophen-2-yl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1c[nH]c2ccccc12)NS(=O)(=O)c1ccc(C#Cc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C23H17N3O6S2/c27-23(28)21(13-16-14-24-20-4-2-1-3-19(16)20)25-34(31,32)22-12-11-18(33-22)10-7-15-5-8-17(9-6-15)26(29)30/h1-6,8-9,11-12,14,21,24-25H,13H2,(H,27,28)/t21-/m1/s1 |
| InChIKey | DIYSOYKZARVATO-OAQYLSRUSA-N |
| XLogP | 3.51 |
| TPSA | 142.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|