About N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine
N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine (PubChem CID 107914095) has the molecular formula C12H23BrF2N2
and a molecular weight of 313.23 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine |
| PubChem CID | 107914095 |
| Molecular Formula | C12H23BrF2N2 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine |
| SMILES | CN1CCCCC1CCN(CCBr)CC(F)F |
| InChI | InChI=1S/C12H23BrF2N2/c1-16-7-3-2-4-11(16)5-8-17(9-6-13)10-12(14)15/h11-12H,2-10H2,1H3 |
| InChIKey | SXQZPZGUAWGLTA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine?
The IUPAC name of N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine (CID 107914095) is N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine.
What is the SMILES notation for N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine?
The canonical SMILES for N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine is CN1CCCCC1CCN(CCBr)CC(F)F.
What is the InChIKey of N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine?
The InChIKey is SXQZPZGUAWGLTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23BrF2N2/c1-16-7-3-2-4-11(16)5-8-17(9-6-13)10-12(14)15/h11-12H,2-10H2,1H3.
What are the key properties of N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine?
N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine has a molecular weight of 313.23 g/mol, XLogP of 2.82, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-2,2-difluoro-N-[2-(1-methylpiperidin-2-yl)ethyl]ethanamine is sourced from PubChem (CID 107914095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).