C15H24N2OS — CID 107914391
2-methyl-4-[2-(1-methylpiperidin-2-yl)ethylsulfinyl]aniline (PubChem CID 107914391) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-methyl-4-[2-(1-methylpiperidin-2-yl)ethylsulfinyl]aniline.
| Compound Name | 2-methyl-4-[2-(1-methylpiperidin-2-yl)ethylsulfinyl]aniline |
|---|---|
| PubChem CID | 107914391 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-methyl-4-[2-(1-methylpiperidin-2-yl)ethylsulfinyl]aniline |
| SMILES | Cc1cc(S(=O)CCC2CCCCN2C)ccc1N |
| InChI | InChI=1S/C15H24N2OS/c1-12-11-14(6-7-15(12)16)19(18)10-8-13-5-3-4-9-17(13)2/h6-7,11,13H,3-5,8-10,16H2,1-2H3 |
| InChIKey | QWNQYQZBEUNDQJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|