C11H8Br2N2S — CID 107916164
5-bromo-2-(2-bromo-4-methylphenyl)-1H-pyrimidine-6-thione (PubChem CID 107916164) has the molecular formula C11H8Br2N2S and a molecular weight of 360.07 g/mol. Its IUPAC name is 5-bromo-2-(2-bromo-4-methylphenyl)-1H-pyrimidine-6-thione.
| Compound Name | 5-bromo-2-(2-bromo-4-methylphenyl)-1H-pyrimidine-6-thione |
|---|---|
| PubChem CID | 107916164 |
| Molecular Formula | C11H8Br2N2S |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 357.88 |
| IUPAC Name | 5-bromo-2-(2-bromo-4-methylphenyl)-1H-pyrimidine-6-thione |
| SMILES | Cc1ccc(-c2ncc(Br)c(=S)[nH]2)c(Br)c1 |
| InChI | InChI=1S/C11H8Br2N2S/c1-6-2-3-7(8(12)4-6)10-14-5-9(13)11(16)15-10/h2-5H,1H3,(H,14,15,16) |
| InChIKey | CNPCXICJGSGUNB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|