C16H14BrN3O — CID 107916362
2-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-methylaniline (PubChem CID 107916362) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is 2-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-methylaniline.
| Compound Name | 2-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-methylaniline |
|---|---|
| PubChem CID | 107916362 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-methylaniline |
| SMILES | Cc1ccc(-c2noc(-c3c(C)cccc3N)n2)cc1Br |
| InChI | InChI=1S/C16H14BrN3O/c1-9-6-7-11(8-12(9)17)15-19-16(21-20-15)14-10(2)4-3-5-13(14)18/h3-8H,18H2,1-2H3 |
| InChIKey | VKENACOXVLJAJO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|