C33H31NO4 — CID 10791668
3-O-ethyl 5-O-(3-phenylpropyl) 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10791668) has the molecular formula C33H31NO4 and a molecular weight of 505.61 g/mol. Its IUPAC name is 3-O-ethyl 5-O-(3-phenylpropyl) 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-(3-phenylpropyl) 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10791668 |
| Molecular Formula | C33H31NO4 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 3-O-ethyl 5-O-(3-phenylpropyl) 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(c2ccccc2)=C(C(=O)OCCCc2ccccc2)C1C#Cc1ccccc1 |
| InChI | InChI=1S/C33H31NO4/c1-3-37-32(35)29-24(2)34-31(27-19-11-6-12-20-27)30(28(29)22-21-26-16-9-5-10-17-26)33(36)38-23-13-18-25-14-7-4-8-15-25/h4-12,14-17,19-20,28,34H,3,13,18,23H2,1-2H3 |
| InChIKey | VXYJRFUWTRZBEZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|