C30H33N7O — CID 10791732
2-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-ylamino)piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine (PubChem CID 10791732) has the molecular formula C30H33N7O and a molecular weight of 507.64 g/mol. Its IUPAC name is 2-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-ylamino)piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine.
| Compound Name | 2-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-ylamino)piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine |
|---|---|
| PubChem CID | 10791732 |
| Molecular Formula | C30H33N7O |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 2-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-ylamino)piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-6-amine |
| SMILES | C=CCNc1nc(N2CCC(NC3c4ccccc4COc4ccccc43)CC2)nc2c1ncn2CC=C |
| InChI | InChI=1S/C30H33N7O/c1-3-15-31-28-27-29(37(16-4-2)20-32-27)35-30(34-28)36-17-13-22(14-18-36)33-26-23-10-6-5-9-21(23)19-38-25-12-8-7-11-24(25)26/h3-12,20,22,26,33H,1-2,13-19H2,(H,31,34,35) |
| InChIKey | ZZUINDNCFCBQEP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|