C16H12Cl2N2S — CID 107917320
1-[(3,4-dichlorophenyl)methyl]indole-6-carbothioamide (PubChem CID 107917320) has the molecular formula C16H12Cl2N2S and a molecular weight of 335.26 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]indole-6-carbothioamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]indole-6-carbothioamide |
|---|---|
| PubChem CID | 107917320 |
| Molecular Formula | C16H12Cl2N2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]indole-6-carbothioamide |
| SMILES | NC(=S)c1ccc2ccn(Cc3ccc(Cl)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C16H12Cl2N2S/c17-13-4-1-10(7-14(13)18)9-20-6-5-11-2-3-12(16(19)21)8-15(11)20/h1-8H,9H2,(H2,19,21) |
| InChIKey | TXODVSGXDLBTKA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|