C21H32O10S2 — CID 10791759
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R)-2-(2-methyl-1,3-dithiolan-2-yl)propoxy]oxan-2-yl]methyl acetate (PubChem CID 10791759) has the molecular formula C21H32O10S2 and a molecular weight of 508.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R)-2-(2-methyl-1,3-dithiolan-2-yl)propoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R)-2-(2-methyl-1,3-dithiolan-2-yl)propoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10791759 |
| Molecular Formula | C21H32O10S2 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R)-2-(2-methyl-1,3-dithiolan-2-yl)propoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC[C@@H](C)C2(C)SCCS2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H32O10S2/c1-11(21(6)32-7-8-33-21)9-27-20-19(30-15(5)25)18(29-14(4)24)17(28-13(3)23)16(31-20)10-26-12(2)22/h11,16-20H,7-10H2,1-6H3/t11-,16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | IYMHLZUESJUIPV-YKWZBALSSA-N |
| XLogP | 1.92 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|