C13H15Cl2N3O — CID 107917796
1-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentan-2-amine (PubChem CID 107917796) has the molecular formula C13H15Cl2N3O and a molecular weight of 300.19 g/mol. Its IUPAC name is 1-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentan-2-amine.
| Compound Name | 1-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentan-2-amine |
|---|---|
| PubChem CID | 107917796 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentan-2-amine |
| SMILES | CCCC(N)Cc1nc(-c2cc(Cl)cc(Cl)c2)no1 |
| InChI | InChI=1S/C13H15Cl2N3O/c1-2-3-11(16)7-12-17-13(18-19-12)8-4-9(14)6-10(15)5-8/h4-6,11H,2-3,7,16H2,1H3 |
| InChIKey | SXDHVCYJNYYAFX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |