C15H14Cl2N2O2 — CID 107918029
ethyl 2-(3,5-dichlorophenyl)-4-ethylpyrimidine-5-carboxylate (PubChem CID 107918029) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is ethyl 2-(3,5-dichlorophenyl)-4-ethylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(3,5-dichlorophenyl)-4-ethylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 107918029 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | ethyl 2-(3,5-dichlorophenyl)-4-ethylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2cc(Cl)cc(Cl)c2)nc1CC |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-3-13-12(15(20)21-4-2)8-18-14(19-13)9-5-10(16)7-11(17)6-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | ISBZBVKFAPKYOI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |