C16H12N2O2 — CID 107918683
3-(2,5-dimethylfuran-3-carbonyl)-1H-indole-4-carbonitrile (PubChem CID 107918683) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-(2,5-dimethylfuran-3-carbonyl)-1H-indole-4-carbonitrile.
| Compound Name | 3-(2,5-dimethylfuran-3-carbonyl)-1H-indole-4-carbonitrile |
|---|---|
| PubChem CID | 107918683 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-(2,5-dimethylfuran-3-carbonyl)-1H-indole-4-carbonitrile |
| SMILES | Cc1cc(C(=O)c2c[nH]c3cccc(C#N)c23)c(C)o1 |
| InChI | InChI=1S/C16H12N2O2/c1-9-6-12(10(2)20-9)16(19)13-8-18-14-5-3-4-11(7-17)15(13)14/h3-6,8,18H,1-2H3 |
| InChIKey | NKIVRTCGJKIFIA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |