C12H9F3N2 — CID 107918977
1-(3,3,3-trifluoropropyl)indole-4-carbonitrile (PubChem CID 107918977) has the molecular formula C12H9F3N2 and a molecular weight of 238.21 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropyl)indole-4-carbonitrile.
| Compound Name | 1-(3,3,3-trifluoropropyl)indole-4-carbonitrile |
|---|---|
| PubChem CID | 107918977 |
| Molecular Formula | C12H9F3N2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-(3,3,3-trifluoropropyl)indole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1ccn2CCC(F)(F)F |
| InChI | InChI=1S/C12H9F3N2/c13-12(14,15)5-7-17-6-4-10-9(8-16)2-1-3-11(10)17/h1-4,6H,5,7H2 |
| InChIKey | CUPRXCXSVZCSGA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |