C18H21F3N2O4 — CID 1079197
[(3S,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 1079197) has the molecular formula C18H21F3N2O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is [(3S,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-(3,4-dimethoxyphenyl)methanone.
| Compound Name | [(3S,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 1079197 |
| Molecular Formula | C18H21F3N2O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [(3S,3aR)-3-hydroxy-3-(trifluoromethyl)-3a,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-2-yl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2N=C3CCCCC[C@H]3[C@]2(O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C18H21F3N2O4/c1-26-14-9-8-11(10-15(14)27-2)16(24)23-17(25,18(19,20)21)12-6-4-3-5-7-13(12)22-23/h8-10,12,25H,3-7H2,1-2H3/t12-,17+/m1/s1 |
| InChIKey | IBCOQCAXKSDFOJ-PXAZEXFGSA-N |
| XLogP | 3.35 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |