C13H9F3N2O2 — CID 107919828
3-[2-(2,2,2-trifluoroethoxy)acetyl]-1H-indole-5-carbonitrile (PubChem CID 107919828) has the molecular formula C13H9F3N2O2 and a molecular weight of 282.22 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroethoxy)acetyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[2-(2,2,2-trifluoroethoxy)acetyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 107919828 |
| Molecular Formula | C13H9F3N2O2 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroethoxy)acetyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(C(=O)COCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C13H9F3N2O2/c14-13(15,16)7-20-6-12(19)10-5-18-11-2-1-8(4-17)3-9(10)11/h1-3,5,18H,6-7H2 |
| InChIKey | IPTZDMFGYZGRNU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |