C28H27N3O7 — CID 10792011
prop-2-enyl (1R,12S)-4-methyl-7-oxo-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carboxylate (PubChem CID 10792011) has the molecular formula C28H27N3O7 and a molecular weight of 517.54 g/mol. Its IUPAC name is prop-2-enyl (1R,12S)-4-methyl-7-oxo-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carboxylate.
| Compound Name | prop-2-enyl (1R,12S)-4-methyl-7-oxo-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carboxylate |
|---|---|
| PubChem CID | 10792011 |
| Molecular Formula | C28H27N3O7 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | prop-2-enyl (1R,12S)-4-methyl-7-oxo-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carboxylate |
| SMILES | C=CCOC(=O)c1c(C)[nH]c2c1[C@@]13C[C@@H]1CN(C(=O)c1cc4cc(OC)c(OC)c(OC)c4[nH]1)C3=CC2=O |
| InChI | InChI=1S/C28H27N3O7/c1-6-7-38-27(34)20-13(2)29-23-17(32)10-19-28(21(20)23)11-15(28)12-31(19)26(33)16-8-14-9-18(35-3)24(36-4)25(37-5)22(14)30-16/h6,8-10,15,29-30H,1,7,11-12H2,2-5H3/t15-,28+/m1/s1 |
| InChIKey | DEENMIVXYSAHMU-JMGYQRAPSA-N |
| XLogP | 3.67 |
| TPSA | 122.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|