C25H51NO6Si2 — CID 10792022
tert-butyl N-[(3aS,4R,5R,6R,6aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamate (PubChem CID 10792022) has the molecular formula C25H51NO6Si2 and a molecular weight of 517.86 g/mol. Its IUPAC name is tert-butyl N-[(3aS,4R,5R,6R,6aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamate.
| Compound Name | tert-butyl N-[(3aS,4R,5R,6R,6aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamate |
|---|---|
| PubChem CID | 10792022 |
| Molecular Formula | C25H51NO6Si2 |
| Molecular Weight | 517.86 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | tert-butyl N-[(3aS,4R,5R,6R,6aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C25H51NO6Si2/c1-22(2,3)30-21(27)26-16-17-19(29-25(10,11)28-17)20(32-34(14,15)24(7,8)9)18(16)31-33(12,13)23(4,5)6/h16-20H,1-15H3,(H,26,27)/t16-,17+,18-,19+,20+/m1/s1 |
| InChIKey | ZJKIXATXVLBXCZ-RMMWZPCPSA-N |
| XLogP | 6.19 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.86 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|