C29H50O4Si2 — CID 10792047
tert-butyl-[[(1S,2R,3R,6S,7R,8R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-15,16-dioxapentacyclo[6.6.1.13,6.01,10.02,7]hexadeca-4,9-dien-7-yl]methoxy]-dimethylsilane (PubChem CID 10792047) has the molecular formula C29H50O4Si2 and a molecular weight of 518.89 g/mol. Its IUPAC name is tert-butyl-[[(1S,2R,3R,6S,7R,8R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-15,16-dioxapentacyclo[6.6.1.13,6.01,10.02,7]hexadeca-4,9-dien-7-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2R,3R,6S,7R,8R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-15,16-dioxapentacyclo[6.6.1.13,6.01,10.02,7]hexadeca-4,9-dien-7-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10792047 |
| Molecular Formula | C29H50O4Si2 |
| Molecular Weight | 518.89 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | tert-butyl-[[(1S,2R,3R,6S,7R,8R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-15,16-dioxapentacyclo[6.6.1.13,6.01,10.02,7]hexadeca-4,9-dien-7-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]12[C@H]3C=C[C@](C)(O3)[C@]1(CO[Si](C)(C)C(C)(C)C)[C@H]1C=C3CCCC[C@]32O1 |
| InChI | InChI=1S/C29H50O4Si2/c1-24(2,3)34(8,9)30-19-27-23-18-21-14-12-13-16-29(21,33-23)28(27,22-15-17-26(27,7)32-22)20-31-35(10,11)25(4,5)6/h15,17-18,22-23H,12-14,16,19-20H2,1-11H3/t22-,23-,26+,27+,28-,29+/m1/s1 |
| InChIKey | YGNPEKQNXMDNQL-HXLGZNCOSA-N |
| XLogP | 7.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.89 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|