C31H35N7O — CID 10792108
6-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-ylmethylamino)piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-2-amine (PubChem CID 10792108) has the molecular formula C31H35N7O and a molecular weight of 521.67 g/mol. Its IUPAC name is 6-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-ylmethylamino)piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-2-amine.
| Compound Name | 6-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-ylmethylamino)piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-2-amine |
|---|---|
| PubChem CID | 10792108 |
| Molecular Formula | C31H35N7O |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | 6-[4-(6,11-dihydrobenzo[c][1]benzoxepin-11-ylmethylamino)piperidin-1-yl]-N,9-bis(prop-2-enyl)purin-2-amine |
| SMILES | C=CCNc1nc(N2CCC(NCC3c4ccccc4COc4ccccc43)CC2)c2ncn(CC=C)c2n1 |
| InChI | InChI=1S/C31H35N7O/c1-3-15-32-31-35-29(28-30(36-31)38(16-4-2)21-34-28)37-17-13-23(14-18-37)33-19-26-24-10-6-5-9-22(24)20-39-27-12-8-7-11-25(26)27/h3-12,21,23,26,33H,1-2,13-20H2,(H,32,35,36) |
| InChIKey | GIUOZHICALWYAR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|