C13H13BrFN3O — CID 107922881
5-bromo-6-ethyl-2-(4-fluoro-3-methoxyphenyl)pyrimidin-4-amine (PubChem CID 107922881) has the molecular formula C13H13BrFN3O and a molecular weight of 326.17 g/mol. Its IUPAC name is 5-bromo-6-ethyl-2-(4-fluoro-3-methoxyphenyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-6-ethyl-2-(4-fluoro-3-methoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107922881 |
| Molecular Formula | C13H13BrFN3O |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-bromo-6-ethyl-2-(4-fluoro-3-methoxyphenyl)pyrimidin-4-amine |
| SMILES | CCc1nc(-c2ccc(F)c(OC)c2)nc(N)c1Br |
| InChI | InChI=1S/C13H13BrFN3O/c1-3-9-11(14)12(16)18-13(17-9)7-4-5-8(15)10(6-7)19-2/h4-6H,3H2,1-2H3,(H2,16,17,18) |
| InChIKey | NYYSUMIZJXQQDC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |