C13H11BrFN3O — CID 107923431
4-[3-(2-bromo-5-fluorophenyl)-1,2,4-oxadiazol-5-yl]cyclopent-2-en-1-amine (PubChem CID 107923431) has the molecular formula C13H11BrFN3O and a molecular weight of 324.15 g/mol. Its IUPAC name is 4-[3-(2-bromo-5-fluorophenyl)-1,2,4-oxadiazol-5-yl]cyclopent-2-en-1-amine.
| Compound Name | 4-[3-(2-bromo-5-fluorophenyl)-1,2,4-oxadiazol-5-yl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 107923431 |
| Molecular Formula | C13H11BrFN3O |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4-[3-(2-bromo-5-fluorophenyl)-1,2,4-oxadiazol-5-yl]cyclopent-2-en-1-amine |
| SMILES | NC1C=CC(c2nc(-c3cc(F)ccc3Br)no2)C1 |
| InChI | InChI=1S/C13H11BrFN3O/c14-11-4-2-8(15)6-10(11)12-17-13(19-18-12)7-1-3-9(16)5-7/h1-4,6-7,9H,5,16H2 |
| InChIKey | YUSLNROLMAXSGB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|