C34H34N2O4 — CID 10792414
2,5-dihydroxy-3,6-bis[[1-(2-methylbut-3-en-2-yl)indol-3-yl]methyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 10792414) has the molecular formula C34H34N2O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2,5-dihydroxy-3,6-bis[[1-(2-methylbut-3-en-2-yl)indol-3-yl]methyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3,6-bis[[1-(2-methylbut-3-en-2-yl)indol-3-yl]methyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10792414 |
| Molecular Formula | C34H34N2O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 2,5-dihydroxy-3,6-bis[[1-(2-methylbut-3-en-2-yl)indol-3-yl]methyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | C=CC(C)(C)n1cc(CC2=C(O)C(=O)C(Cc3cn(C(C)(C)C=C)c4ccccc34)=C(O)C2=O)c2ccccc21 |
| InChI | InChI=1S/C34H34N2O4/c1-7-33(3,4)35-19-21(23-13-9-11-15-27(23)35)17-25-29(37)31(39)26(32(40)30(25)38)18-22-20-36(34(5,6)8-2)28-16-12-10-14-24(22)28/h7-16,19-20,37,40H,1-2,17-18H2,3-6H3 |
| InChIKey | IEKPQBUQALXCQO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|