C24H32F3NO9 — CID 10792433
ethyl (2R,4R,6S)-2-(acetyloxymethyl)-4-(methoxymethoxy)-6-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxymethyl]piperidine-1-carboxylate (PubChem CID 10792433) has the molecular formula C24H32F3NO9 and a molecular weight of 535.51 g/mol. Its IUPAC name is ethyl (2R,4R,6S)-2-(acetyloxymethyl)-4-(methoxymethoxy)-6-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxymethyl]piperidine-1-carboxylate.
| Compound Name | ethyl (2R,4R,6S)-2-(acetyloxymethyl)-4-(methoxymethoxy)-6-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10792433 |
| Molecular Formula | C24H32F3NO9 |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | ethyl (2R,4R,6S)-2-(acetyloxymethyl)-4-(methoxymethoxy)-6-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxymethyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1[C@H](COC(=O)C(OC)(c2ccccc2)C(F)(F)F)C[C@H](OCOC)C[C@@H]1COC(C)=O |
| InChI | InChI=1S/C24H32F3NO9/c1-5-34-22(31)28-18(13-35-16(2)29)11-20(37-15-32-3)12-19(28)14-36-21(30)23(33-4,24(25,26)27)17-9-7-6-8-10-17/h6-10,18-20H,5,11-15H2,1-4H3/t18-,19+,20-,23?/m1/s1 |
| InChIKey | LXFKPGRRPDKBRE-MLJUJGDHSA-N |
| XLogP | 3.18 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|