C32H40O7 — CID 10792467
methyl (3S,3aS,4R,6aR,10aR)-4-(1-hydroxy-4-phenylmethoxybutyl)-5-oxo-3-phenylmethoxy-3a,4,6,6a,7,8,9,10-octahydro-1H-benzo[d][2]benzofuran-3-carboxylate (PubChem CID 10792467) has the molecular formula C32H40O7 and a molecular weight of 536.67 g/mol. Its IUPAC name is methyl (3S,3aS,4R,6aR,10aR)-4-(1-hydroxy-4-phenylmethoxybutyl)-5-oxo-3-phenylmethoxy-3a,4,6,6a,7,8,9,10-octahydro-1H-benzo[d][2]benzofuran-3-carboxylate.
| Compound Name | methyl (3S,3aS,4R,6aR,10aR)-4-(1-hydroxy-4-phenylmethoxybutyl)-5-oxo-3-phenylmethoxy-3a,4,6,6a,7,8,9,10-octahydro-1H-benzo[d][2]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 10792467 |
| Molecular Formula | C32H40O7 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | methyl (3S,3aS,4R,6aR,10aR)-4-(1-hydroxy-4-phenylmethoxybutyl)-5-oxo-3-phenylmethoxy-3a,4,6,6a,7,8,9,10-octahydro-1H-benzo[d][2]benzofuran-3-carboxylate |
| SMILES | COC(=O)[C@@]1(OCc2ccccc2)OC[C@]23CCCC[C@@H]2CC(=O)[C@@H](C(O)CCCOCc2ccccc2)[C@H]13 |
| InChI | InChI=1S/C32H40O7/c1-36-30(35)32(38-21-24-13-6-3-7-14-24)29-28(26(33)16-10-18-37-20-23-11-4-2-5-12-23)27(34)19-25-15-8-9-17-31(25,29)22-39-32/h2-7,11-14,25-26,28-29,33H,8-10,15-22H2,1H3/t25-,26?,28-,29+,31-,32+/m1/s1 |
| InChIKey | VDRURFHNNYRRHA-XDVVQFAOSA-N |
| XLogP | 4.84 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|