C14H12BrFN2S — CID 107924888
2-(2-bromo-5-fluorophenyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 107924888) has the molecular formula C14H12BrFN2S and a molecular weight of 339.23 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 107924888 |
| Molecular Formula | C14H12BrFN2S |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | Fc1ccc(Br)c(-c2nc(=S)c3c([nH]2)CCCC3)c1 |
| InChI | InChI=1S/C14H12BrFN2S/c15-11-6-5-8(16)7-10(11)13-17-12-4-2-1-3-9(12)14(19)18-13/h5-7H,1-4H2,(H,17,18,19) |
| InChIKey | YAADMVCOJFIDJK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|