About 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine
5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine (PubChem CID 107925692) has the molecular formula C10H14BrN3
and a molecular weight of 256.15 g/mol. Its IUPAC name is 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine |
| PubChem CID | 107925692 |
| Molecular Formula | C10H14BrN3 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1nc(C2CC2(C)C)nc(N)c1Br |
| InChI | InChI=1S/C10H14BrN3/c1-5-7(11)8(12)14-9(13-5)6-4-10(6,2)3/h6H,4H2,1-3H3,(H2,12,13,14) |
| InChIKey | HQYMBYJOSUJTJR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine?
The IUPAC name of 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine (CID 107925692) is 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine.
What is the SMILES notation for 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine?
The canonical SMILES for 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine is Cc1nc(C2CC2(C)C)nc(N)c1Br.
What is the InChIKey of 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine?
The InChIKey is HQYMBYJOSUJTJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN3/c1-5-7(11)8(12)14-9(13-5)6-4-10(6,2)3/h6H,4H2,1-3H3,(H2,12,13,14).
What are the key properties of 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine?
5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine has a molecular weight of 256.15 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(2,2-dimethylcyclopropyl)-6-methylpyrimidin-4-amine is sourced from PubChem (CID 107925692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).