C35H50O3Si — CID 10792687
(1S,2S,6R,7R)-5-[(E,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-4-[(1S,2R)-2-phenylcyclohexyl]oxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 10792687) has the molecular formula C35H50O3Si and a molecular weight of 546.87 g/mol. Its IUPAC name is (1S,2S,6R,7R)-5-[(E,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-4-[(1S,2R)-2-phenylcyclohexyl]oxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2S,6R,7R)-5-[(E,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-4-[(1S,2R)-2-phenylcyclohexyl]oxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 10792687 |
| Molecular Formula | C35H50O3Si |
| Molecular Weight | 546.87 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | (1S,2S,6R,7R)-5-[(E,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-4-[(1S,2R)-2-phenylcyclohexyl]oxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | C[C@@H](CCC/C=C/C1=C(O[C@H]2CCCC[C@@H]2c2ccccc2)C(=O)[C@@H]2[C@H]1[C@H]1C=C[C@@H]2C1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H50O3Si/c1-24(38-39(5,6)35(2,3)4)15-9-7-12-19-29-31-26-21-22-27(23-26)32(31)33(36)34(29)37-30-20-14-13-18-28(30)25-16-10-8-11-17-25/h8,10-12,16-17,19,21-22,24,26-28,30-32H,7,9,13-15,18,20,23H2,1-6H3/b19-12+/t24-,26-,27+,28+,30-,31-,32-/m0/s1 |
| InChIKey | ANDNODVCVRWZQG-KPEFWXJSSA-N |
| XLogP | 9.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.87 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|