C29H45NO7Si — CID 10792702
12-O-tert-butyl 11-O-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (1S,8S)-10-[tert-butyl(dimethyl)silyl]oxy-12-azatricyclo[6.3.1.01,6]dodeca-6,10-diene-11,12-dicarboxylate (PubChem CID 10792702) has the molecular formula C29H45NO7Si and a molecular weight of 547.77 g/mol. Its IUPAC name is 12-O-tert-butyl 11-O-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (1S,8S)-10-[tert-butyl(dimethyl)silyl]oxy-12-azatricyclo[6.3.1.01,6]dodeca-6,10-diene-11,12-dicarboxylate.
| Compound Name | 12-O-tert-butyl 11-O-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (1S,8S)-10-[tert-butyl(dimethyl)silyl]oxy-12-azatricyclo[6.3.1.01,6]dodeca-6,10-diene-11,12-dicarboxylate |
|---|---|
| PubChem CID | 10792702 |
| Molecular Formula | C29H45NO7Si |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | 12-O-tert-butyl 11-O-[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (1S,8S)-10-[tert-butyl(dimethyl)silyl]oxy-12-azatricyclo[6.3.1.01,6]dodeca-6,10-diene-11,12-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C=C3CCCC[C@@]31C(C(=O)O[C@H]1C(=O)OCC1(C)C)=C(O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C29H45NO7Si/c1-26(2,3)36-25(33)30-19-15-18-13-11-12-14-29(18,30)21(20(16-19)37-38(9,10)27(4,5)6)23(31)35-22-24(32)34-17-28(22,7)8/h15,19,22H,11-14,16-17H2,1-10H3/t19-,22+,29+/m1/s1 |
| InChIKey | GXYKKRODVZNIDK-FFSNCUIWSA-N |
| XLogP | 6.02 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|