C31H34O7S — CID 10792766
[(2S,3R,4S,5R,6R)-6-(acetyloxymethyl)-2-ethylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate (PubChem CID 10792766) has the molecular formula C31H34O7S and a molecular weight of 550.67 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-6-(acetyloxymethyl)-2-ethylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-6-(acetyloxymethyl)-2-ethylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 10792766 |
| Molecular Formula | C31H34O7S |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-6-(acetyloxymethyl)-2-ethylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
| SMILES | CCS[C@@H]1O[C@H](COC(C)=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H34O7S/c1-3-39-31-29(38-30(33)25-17-11-6-12-18-25)28(36-20-24-15-9-5-10-16-24)27(26(37-31)21-34-22(2)32)35-19-23-13-7-4-8-14-23/h4-18,26-29,31H,3,19-21H2,1-2H3/t26-,27-,28+,29-,31+/m1/s1 |
| InChIKey | IQAPZYSDHXGMTI-KBMGTAGUSA-N |
| XLogP | 5.42 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |