C29H33F2N5O4 — CID 10792830
4-[[2-[5-amino-2-(3-methylphenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-2,2-difluoro-3-oxo-N-pentyl-5-phenylpentanamide (PubChem CID 10792830) has the molecular formula C29H33F2N5O4 and a molecular weight of 553.61 g/mol. Its IUPAC name is 4-[[2-[5-amino-2-(3-methylphenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-2,2-difluoro-3-oxo-N-pentyl-5-phenylpentanamide.
| Compound Name | 4-[[2-[5-amino-2-(3-methylphenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-2,2-difluoro-3-oxo-N-pentyl-5-phenylpentanamide |
|---|---|
| PubChem CID | 10792830 |
| Molecular Formula | C29H33F2N5O4 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 4-[[2-[5-amino-2-(3-methylphenyl)-6-oxopyrimidin-1-yl]acetyl]amino]-2,2-difluoro-3-oxo-N-pentyl-5-phenylpentanamide |
| SMILES | CCCCCNC(=O)C(F)(F)C(=O)C(Cc1ccccc1)NC(=O)Cn1c(-c2cccc(C)c2)ncc(N)c1=O |
| InChI | InChI=1S/C29H33F2N5O4/c1-3-4-8-14-33-28(40)29(30,31)25(38)23(16-20-11-6-5-7-12-20)35-24(37)18-36-26(34-17-22(32)27(36)39)21-13-9-10-19(2)15-21/h5-7,9-13,15,17,23H,3-4,8,14,16,18,32H2,1-2H3,(H,33,40)(H,35,37) |
| InChIKey | HCFCPJNPHOFKAO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|