C16H26N2S — CID 107928650
2-[ethyl(2-ethylbutyl)amino]-5-methylbenzenecarbothioamide (PubChem CID 107928650) has the molecular formula C16H26N2S and a molecular weight of 278.47 g/mol. Its IUPAC name is 2-[ethyl(2-ethylbutyl)amino]-5-methylbenzenecarbothioamide.
| Compound Name | 2-[ethyl(2-ethylbutyl)amino]-5-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107928650 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-[ethyl(2-ethylbutyl)amino]-5-methylbenzenecarbothioamide |
| SMILES | CCC(CC)CN(CC)c1ccc(C)cc1C(N)=S |
| InChI | InChI=1S/C16H26N2S/c1-5-13(6-2)11-18(7-3)15-9-8-12(4)10-14(15)16(17)19/h8-10,13H,5-7,11H2,1-4H3,(H2,17,19) |
| InChIKey | FNXVJRONHHAWPO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|