C24H45O12P — CID 10792890
methyl (2S,3S,4aR,6S,8S,8aR)-8-[[diethoxymethyl(ethoxy)phosphoryl]methyl]-2,3-dimethoxy-6-(methoxymethoxy)-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxine-6-carboxylate (PubChem CID 10792890) has the molecular formula C24H45O12P and a molecular weight of 556.59 g/mol. Its IUPAC name is methyl (2S,3S,4aR,6S,8S,8aR)-8-[[diethoxymethyl(ethoxy)phosphoryl]methyl]-2,3-dimethoxy-6-(methoxymethoxy)-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxine-6-carboxylate.
| Compound Name | methyl (2S,3S,4aR,6S,8S,8aR)-8-[[diethoxymethyl(ethoxy)phosphoryl]methyl]-2,3-dimethoxy-6-(methoxymethoxy)-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 10792890 |
| Molecular Formula | C24H45O12P |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | methyl (2S,3S,4aR,6S,8S,8aR)-8-[[diethoxymethyl(ethoxy)phosphoryl]methyl]-2,3-dimethoxy-6-(methoxymethoxy)-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxine-6-carboxylate |
| SMILES | CCOC(OCC)P(=O)(C[C@H]1C[C@@](OCOC)(C(=O)OC)C[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@H]12)OCC |
| InChI | InChI=1S/C24H45O12P/c1-10-31-21(32-11-2)37(26,34-12-3)15-17-13-24(20(25)28-7,33-16-27-6)14-18-19(17)36-23(5,30-9)22(4,29-8)35-18/h17-19,21H,10-16H2,1-9H3/t17-,18-,19-,22+,23+,24+,37?/m1/s1 |
| InChIKey | WXUKNOCZOZPTKV-ZFAOZRRTSA-N |
| XLogP | 3.11 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|