C35H48O4Si — CID 10792988
(5R,6S,8Z,11E)-6-[tert-butyl(diphenyl)silyl]oxy-1-(oxan-2-yloxy)tetradeca-8,11-dien-2-yn-5-ol (PubChem CID 10792988) has the molecular formula C35H48O4Si and a molecular weight of 560.85 g/mol. Its IUPAC name is (5R,6S,8Z,11E)-6-[tert-butyl(diphenyl)silyl]oxy-1-(oxan-2-yloxy)tetradeca-8,11-dien-2-yn-5-ol.
| Compound Name | (5R,6S,8Z,11E)-6-[tert-butyl(diphenyl)silyl]oxy-1-(oxan-2-yloxy)tetradeca-8,11-dien-2-yn-5-ol |
|---|---|
| PubChem CID | 10792988 |
| Molecular Formula | C35H48O4Si |
| Molecular Weight | 560.85 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | (5R,6S,8Z,11E)-6-[tert-butyl(diphenyl)silyl]oxy-1-(oxan-2-yloxy)tetradeca-8,11-dien-2-yn-5-ol |
| SMILES | CC/C=C/C/C=C\C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)CC#CCOC1CCCCO1 |
| InChI | InChI=1S/C35H48O4Si/c1-5-6-7-8-9-16-26-33(32(36)25-17-19-28-37-34-27-18-20-29-38-34)39-40(35(2,3)4,30-21-12-10-13-22-30)31-23-14-11-15-24-31/h6-7,9-16,21-24,32-34,36H,5,8,18,20,25-29H2,1-4H3/b7-6+,16-9-/t32-,33+,34?/m1/s1 |
| InChIKey | AADBGAYZFFSKMS-RGEAOQCKSA-N |
| XLogP | 6.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.85 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|