C10H12F2N2O2 — CID 107930246
2-(2,2-difluoroethoxy)-N'-hydroxy-5-methylbenzenecarboximidamide (PubChem CID 107930246) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N'-hydroxy-5-methylbenzenecarboximidamide.
| Compound Name | 2-(2,2-difluoroethoxy)-N'-hydroxy-5-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107930246 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N'-hydroxy-5-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(OCC(F)F)c(/C(N)=N/O)c1 |
| InChI | InChI=1S/C10H12F2N2O2/c1-6-2-3-8(16-5-9(11)12)7(4-6)10(13)14-15/h2-4,9,15H,5H2,1H3,(H2,13,14) |
| InChIKey | QJXIKENXJDTOHT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|