C29H43NO10 — CID 10793070
2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaen-17-ylmethanamine (PubChem CID 10793070) has the molecular formula C29H43NO10 and a molecular weight of 565.66 g/mol. Its IUPAC name is 2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaen-17-ylmethanamine.
| Compound Name | 2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaen-17-ylmethanamine |
|---|---|
| PubChem CID | 10793070 |
| Molecular Formula | C29H43NO10 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaen-17-ylmethanamine |
| SMILES | NCc1cc2cc(c1)OCCOCCOCCOCCOc1cccc(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C29H43NO10/c30-24-25-20-28-23-29(21-25)40-19-15-36-11-7-32-5-9-34-13-17-38-27-3-1-2-26(22-27)37-16-12-33-8-4-31-6-10-35-14-18-39-28/h1-3,20-23H,4-19,24,30H2 |
| InChIKey | OJWLWWLYKOTKFK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |