C15H22N2O — CID 107931329
2-[(2-hydroxy-4,4-dimethylpentyl)amino]-5-methylbenzonitrile (PubChem CID 107931329) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-[(2-hydroxy-4,4-dimethylpentyl)amino]-5-methylbenzonitrile.
| Compound Name | 2-[(2-hydroxy-4,4-dimethylpentyl)amino]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 107931329 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-[(2-hydroxy-4,4-dimethylpentyl)amino]-5-methylbenzonitrile |
| SMILES | Cc1ccc(NCC(O)CC(C)(C)C)c(C#N)c1 |
| InChI | InChI=1S/C15H22N2O/c1-11-5-6-14(12(7-11)9-16)17-10-13(18)8-15(2,3)4/h5-7,13,17-18H,8,10H2,1-4H3 |
| InChIKey | JAUCEQBDDYZNGT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |