C30H39NO8Si — CID 10793149
ethyl (3R)-2-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-oxo-1,2-oxazolidine-3-carboxylate (PubChem CID 10793149) has the molecular formula C30H39NO8Si and a molecular weight of 569.73 g/mol. Its IUPAC name is ethyl (3R)-2-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-oxo-1,2-oxazolidine-3-carboxylate.
| Compound Name | ethyl (3R)-2-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-oxo-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10793149 |
| Molecular Formula | C30H39NO8Si |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | ethyl (3R)-2-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-oxo-1,2-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(=O)ON1[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C30H39NO8Si/c1-7-34-28(33)22-18-24(32)39-31(22)27-26-25(37-30(5,6)38-26)23(36-27)19-35-40(29(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22-23,25-27H,7,18-19H2,1-6H3/t22-,23-,25-,26-,27-/m1/s1 |
| InChIKey | KKENZRZYRNEGPY-WQWGDOPQSA-N |
| XLogP | 2.90 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|